C32H51NO4Si2 — CID 134850812
(3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one (PubChem CID 134850812) has the molecular formula C32H51NO4Si2 and a molecular weight of 569.94 g/mol. Its IUPAC name is (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134850812 |
| Molecular Formula | C32H51NO4Si2 |
| Molecular Weight | 569.94 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[2-(4-methoxyphenyl)ethyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CC[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H51NO4Si2/c1-31(2,3)38(8,9)36-28-27(22-19-24-17-20-26(35-7)21-18-24)33(23-25-15-13-12-14-16-25)30(34)29(28)37-39(10,11)32(4,5)6/h12-18,20-21,27-29H,19,22-23H2,1-11H3/t27-,28+,29-/m1/s1 |
| InChIKey | BZENVDXIHZDRBQ-SSBOKUKZSA-N |
| XLogP | 7.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.94 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|