C19H20N2O4 — CID 134850883
ethyl 2-(3a,7a-dihydro-1H-indol-3-yl)-3-nitro-2-phenylpropanoate (PubChem CID 134850883) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 2-(3a,7a-dihydro-1H-indol-3-yl)-3-nitro-2-phenylpropanoate.
| Compound Name | ethyl 2-(3a,7a-dihydro-1H-indol-3-yl)-3-nitro-2-phenylpropanoate |
|---|---|
| PubChem CID | 134850883 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl 2-(3a,7a-dihydro-1H-indol-3-yl)-3-nitro-2-phenylpropanoate |
| SMILES | CCOC(=O)C(C[N+](=O)[O-])(C1=CNC2C=CC=CC12)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-2-25-18(22)19(13-21(23)24,14-8-4-3-5-9-14)16-12-20-17-11-7-6-10-15(16)17/h3-12,15,17,20H,2,13H2,1H3 |
| InChIKey | YTZFXYRZEJHWFW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|