C6H12N3+ — CID 134850922
1-ethyl-3,4-dimethyl-1,2,4-triazol-4-ium (PubChem CID 134850922) has the molecular formula C6H12N3+ and a molecular weight of 126.18 g/mol. Its IUPAC name is 1-ethyl-3,4-dimethyl-1,2,4-triazol-4-ium.
| Compound Name | 1-ethyl-3,4-dimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 134850922 |
| Molecular Formula | C6H12N3+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 1-ethyl-3,4-dimethyl-1,2,4-triazol-4-ium |
| SMILES | CCn1c[n+](C)c(C)n1 |
| InChI | InChI=1S/C6H12N3/c1-4-9-5-8(3)6(2)7-9/h5H,4H2,1-3H3/q+1 |
| InChIKey | MUXGWWFBNDOAET-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|