C10H8N2O — CID 134851058
9H-pyrazolo[5,1-b][1,3]benzoxazine (PubChem CID 134851058) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 9H-pyrazolo[5,1-b][1,3]benzoxazine.
| Compound Name | 9H-pyrazolo[5,1-b][1,3]benzoxazine |
|---|---|
| PubChem CID | 134851058 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 9H-pyrazolo[5,1-b][1,3]benzoxazine |
| SMILES | c1ccc2c(c1)Cn1nccc1O2 |
| InChI | InChI=1S/C10H8N2O/c1-2-4-9-8(3-1)7-12-10(13-9)5-6-11-12/h1-6H,7H2 |
| InChIKey | NEPYARKHCRSFPW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |