C16H31IO5Si — CID 134851103
[(3aS,4S,6S,7S,7aR)-6-(iodomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane (PubChem CID 134851103) has the molecular formula C16H31IO5Si and a molecular weight of 458.41 g/mol. Its IUPAC name is [(3aS,4S,6S,7S,7aR)-6-(iodomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane.
| Compound Name | [(3aS,4S,6S,7S,7aR)-6-(iodomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134851103 |
| Molecular Formula | C16H31IO5Si |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [(3aS,4S,6S,7S,7aR)-6-(iodomethyl)-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](OC)O[C@@H]1CI |
| InChI | InChI=1S/C16H31IO5Si/c1-7-23(8-2,9-3)22-12-11(10-17)19-15(18-6)14-13(12)20-16(4,5)21-14/h11-15H,7-10H2,1-6H3/t11-,12-,13+,14+,15+/m1/s1 |
| InChIKey | VKODTHNOKYUEHC-MRLBHPIUSA-N |
| XLogP | 3.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|