C17H20F3NO3S — CID 134851163
(S)-2-methyl-N-[(2S,4Z)-1,1,1-trifluoro-4-(2-oxo-1-benzofuran-3-ylidene)pentan-2-yl]propane-2-sulfinamide (PubChem CID 134851163) has the molecular formula C17H20F3NO3S and a molecular weight of 375.41 g/mol. Its IUPAC name is (S)-2-methyl-N-[(2S,4Z)-1,1,1-trifluoro-4-(2-oxo-1-benzofuran-3-ylidene)pentan-2-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(2S,4Z)-1,1,1-trifluoro-4-(2-oxo-1-benzofuran-3-ylidene)pentan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 134851163 |
| Molecular Formula | C17H20F3NO3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (S)-2-methyl-N-[(2S,4Z)-1,1,1-trifluoro-4-(2-oxo-1-benzofuran-3-ylidene)pentan-2-yl]propane-2-sulfinamide |
| SMILES | C/C(C[C@H](N[S@@](=O)C(C)(C)C)C(F)(F)F)=C1/C(=O)Oc2ccccc21 |
| InChI | InChI=1S/C17H20F3NO3S/c1-10(14-11-7-5-6-8-12(11)24-15(14)22)9-13(17(18,19)20)21-25(23)16(2,3)4/h5-8,13,21H,9H2,1-4H3/b14-10-/t13-,25-/m0/s1 |
| InChIKey | KXROKVBOAJQXRW-XDRVFSDGSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|