About 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol
2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol (PubChem CID 134851305) has the molecular formula C9H19N2O+
and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol |
| PubChem CID | 134851305 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol |
| SMILES | CCCC[N+]1=CN(CCO)CC1 |
| InChI | InChI=1S/C9H19N2O/c1-2-3-4-10-5-6-11(9-10)7-8-12/h9,12H,2-8H2,1H3/q+1 |
| InChIKey | LAYALRWAFOULFG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol?
The IUPAC name of 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol (CID 134851305) is 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol.
What is the SMILES notation for 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol?
The canonical SMILES for 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol is CCCC[N+]1=CN(CCO)CC1.
What is the InChIKey of 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol?
The InChIKey is LAYALRWAFOULFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N2O/c1-2-3-4-10-5-6-11(9-10)7-8-12/h9,12H,2-8H2,1H3/q+1.
What are the key properties of 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol?
2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol has a molecular weight of 171.26 g/mol, XLogP of 0.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-butyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol is sourced from PubChem (CID 134851305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).