C21H37N3O6 — CID 134851745
1-O,9-O-ditert-butyl 3-O-ethyl 1,4,9-triazaspiro[5.5]undecane-1,3,9-tricarboxylate (PubChem CID 134851745) has the molecular formula C21H37N3O6 and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-O,9-O-ditert-butyl 3-O-ethyl 1,4,9-triazaspiro[5.5]undecane-1,3,9-tricarboxylate.
| Compound Name | 1-O,9-O-ditert-butyl 3-O-ethyl 1,4,9-triazaspiro[5.5]undecane-1,3,9-tricarboxylate |
|---|---|
| PubChem CID | 134851745 |
| Molecular Formula | C21H37N3O6 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 1-O,9-O-ditert-butyl 3-O-ethyl 1,4,9-triazaspiro[5.5]undecane-1,3,9-tricarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)C2(CCN(C(=O)OC(C)(C)C)CC2)CN1 |
| InChI | InChI=1S/C21H37N3O6/c1-8-28-16(25)15-13-24(18(27)30-20(5,6)7)21(14-22-15)9-11-23(12-10-21)17(26)29-19(2,3)4/h15,22H,8-14H2,1-7H3 |
| InChIKey | ICRMFSFJUWUMQD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|