C16H14ClNO2 — CID 134851900
(3S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidin-5-one (PubChem CID 134851900) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is (3S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidin-5-one.
| Compound Name | (3S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 134851900 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (3S)-2-benzyl-3-(4-chlorophenyl)-1,2-oxazolidin-5-one |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H14ClNO2/c17-14-8-6-13(7-9-14)15-10-16(19)20-18(15)11-12-4-2-1-3-5-12/h1-9,15H,10-11H2/t15-/m0/s1 |
| InChIKey | KORPGYULSGKFEE-HNNXBMFYSA-N |
| XLogP | 3.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |