About [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate
[bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate (PubChem CID 134852139) has the molecular formula C15H14F3IO5S
and a molecular weight of 490.24 g/mol. Its IUPAC name is [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| PubChem CID | 134852139 |
| Molecular Formula | C15H14F3IO5S |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(I(OS(=O)(=O)C(F)(F)F)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C15H14F3IO5S/c1-22-13-7-3-11(4-8-13)19(24-25(20,21)15(16,17)18)12-5-9-14(23-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | YBPCFWANDBVCGM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The IUPAC name of [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate (CID 134852139) is [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate.
What is the SMILES notation for [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The canonical SMILES for [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate is COc1ccc(I(OS(=O)(=O)C(F)(F)F)c2ccc(OC)cc2)cc1.
What is the InChIKey of [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
The InChIKey is YBPCFWANDBVCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3IO5S/c1-22-13-7-3-11(4-8-13)19(24-25(20,21)15(16,17)18)12-5-9-14(23-2)10-6-12/h3-10H,1-2H3.
What are the key properties of [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate?
[bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate has a molecular weight of 490.24 g/mol, XLogP of 4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(4-methoxyphenyl)-λ3-iodanyl] trifluoromethanesulfonate is sourced from PubChem (CID 134852139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).