C13H29IOSi — CID 134852142
3,7-dimethyloctoxy-(iodomethyl)-dimethylsilane (PubChem CID 134852142) has the molecular formula C13H29IOSi and a molecular weight of 356.36 g/mol. Its IUPAC name is 3,7-dimethyloctoxy-(iodomethyl)-dimethylsilane.
| Compound Name | 3,7-dimethyloctoxy-(iodomethyl)-dimethylsilane |
|---|---|
| PubChem CID | 134852142 |
| Molecular Formula | C13H29IOSi |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3,7-dimethyloctoxy-(iodomethyl)-dimethylsilane |
| SMILES | CC(C)CCCC(C)CCO[Si](C)(C)CI |
| InChI | InChI=1S/C13H29IOSi/c1-12(2)7-6-8-13(3)9-10-15-16(4,5)11-14/h12-13H,6-11H2,1-5H3 |
| InChIKey | YGEUFECQWXWAGI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|