C14H18N6O2S3 — CID 134852334
N'-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanylmethyl]-N-(4-methylphenyl)sulfonylmethanimidamide (PubChem CID 134852334) has the molecular formula C14H18N6O2S3 and a molecular weight of 398.54 g/mol. Its IUPAC name is N'-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanylmethyl]-N-(4-methylphenyl)sulfonylmethanimidamide.
| Compound Name | N'-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanylmethyl]-N-(4-methylphenyl)sulfonylmethanimidamide |
|---|---|
| PubChem CID | 134852334 |
| Molecular Formula | C14H18N6O2S3 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N'-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanylmethyl]-N-(4-methylphenyl)sulfonylmethanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)N/C=N/CSCc2csc(N=C(N)N)n2)cc1 |
| InChI | InChI=1S/C14H18N6O2S3/c1-10-2-4-12(5-3-10)25(21,22)18-8-17-9-23-6-11-7-24-14(19-11)20-13(15)16/h2-5,7-8H,6,9H2,1H3,(H,17,18)(H4,15,16,19,20) |
| InChIKey | ONPVUKTZBSTMFF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|