C14H25NO2 — CID 134852422
(4E,5R,9S,10S)-10-butyl-4-hydroxyiminospiro[4.5]decan-9-ol (PubChem CID 134852422) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (4E,5R,9S,10S)-10-butyl-4-hydroxyiminospiro[4.5]decan-9-ol.
| Compound Name | (4E,5R,9S,10S)-10-butyl-4-hydroxyiminospiro[4.5]decan-9-ol |
|---|---|
| PubChem CID | 134852422 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (4E,5R,9S,10S)-10-butyl-4-hydroxyiminospiro[4.5]decan-9-ol |
| SMILES | CCCC[C@@H]1[C@@H](O)CCC[C@]12CCC/C2=N\O |
| InChI | InChI=1S/C14H25NO2/c1-2-3-6-11-12(16)7-4-9-14(11)10-5-8-13(14)15-17/h11-12,16-17H,2-10H2,1H3/b15-13+/t11-,12+,14+/m1/s1 |
| InChIKey | OEWINPPEPMAEEY-RITGRWPESA-N |
| XLogP | 3.34 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|