C25H45NO4Si2 — CID 134852477
benzyl N-[(2S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]carbamate (PubChem CID 134852477) has the molecular formula C25H45NO4Si2 and a molecular weight of 479.81 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134852477 |
| Molecular Formula | C25H45NO4Si2 |
| Molecular Weight | 479.81 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | benzyl N-[(2S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-en-2-yl]carbamate |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H45NO4Si2/c1-12-22(30-32(10,11)25(5,6)7)21(19-29-31(8,9)24(2,3)4)26-23(27)28-18-20-16-14-13-15-17-20/h12-17,21-22H,1,18-19H2,2-11H3,(H,26,27)/t21-,22-/m0/s1 |
| InChIKey | NSZDHVPCFUUKNN-VXKWHMMOSA-N |
| XLogP | 6.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|