About [(3R)-hexa-1,5-dien-3-yl]cyclohexane
[(3R)-hexa-1,5-dien-3-yl]cyclohexane (PubChem CID 134852665) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is [(3R)-hexa-1,5-dien-3-yl]cyclohexane.
Molecular Properties
| Compound Name | [(3R)-hexa-1,5-dien-3-yl]cyclohexane |
| PubChem CID | 134852665 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | [(3R)-hexa-1,5-dien-3-yl]cyclohexane |
| SMILES | C=CC[C@H](C=C)C1CCCCC1 |
| InChI | InChI=1S/C12H20/c1-3-8-11(4-2)12-9-6-5-7-10-12/h3-4,11-12H,1-2,5-10H2/t11-/m0/s1 |
| InChIKey | CMGIUXHIZVCAEG-NSHDSACASA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-hexa-1,5-dien-3-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-hexa-1,5-dien-3-yl]cyclohexane?
The IUPAC name of [(3R)-hexa-1,5-dien-3-yl]cyclohexane (CID 134852665) is [(3R)-hexa-1,5-dien-3-yl]cyclohexane.
What is the SMILES notation for [(3R)-hexa-1,5-dien-3-yl]cyclohexane?
The canonical SMILES for [(3R)-hexa-1,5-dien-3-yl]cyclohexane is C=CC[C@H](C=C)C1CCCCC1.
What is the InChIKey of [(3R)-hexa-1,5-dien-3-yl]cyclohexane?
The InChIKey is CMGIUXHIZVCAEG-NSHDSACASA-N. The full InChI is InChI=1S/C12H20/c1-3-8-11(4-2)12-9-6-5-7-10-12/h3-4,11-12H,1-2,5-10H2/t11-/m0/s1.
What are the key properties of [(3R)-hexa-1,5-dien-3-yl]cyclohexane?
[(3R)-hexa-1,5-dien-3-yl]cyclohexane has a molecular weight of 164.29 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-hexa-1,5-dien-3-yl]cyclohexane is sourced from PubChem (CID 134852665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).