About (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid
(2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid (PubChem CID 134852828) has the molecular formula C15H11Br3O6
and a molecular weight of 526.96 g/mol. Its IUPAC name is (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid.
Molecular Properties
| Compound Name | (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid |
| PubChem CID | 134852828 |
| Molecular Formula | C15H11Br3O6 |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 523.81 |
| IUPAC Name | (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid |
| SMILES | COc1c(O)cc([C@H](C(=O)O)c2cc(O)c(O)c(Br)c2Br)cc1Br |
| InChI | InChI=1S/C15H11Br3O6/c1-24-14-7(16)2-5(3-9(14)20)10(15(22)23)6-4-8(19)13(21)12(18)11(6)17/h2-4,10,19-21H,1H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | JOTRTLAVSWDUMF-JTQLQIEISA-N |
| XLogP | 4.32 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid?
The IUPAC name of (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid (CID 134852828) is (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid.
What is the SMILES notation for (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid?
The canonical SMILES for (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid is COc1c(O)cc([C@H](C(=O)O)c2cc(O)c(O)c(Br)c2Br)cc1Br.
What is the InChIKey of (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid?
The InChIKey is JOTRTLAVSWDUMF-JTQLQIEISA-N. The full InChI is InChI=1S/C15H11Br3O6/c1-24-14-7(16)2-5(3-9(14)20)10(15(22)23)6-4-8(19)13(21)12(18)11(6)17/h2-4,10,19-21H,1H3,(H,22,23)/t10-/m0/s1.
What are the key properties of (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid?
(2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid has a molecular weight of 526.96 g/mol, XLogP of 4.32, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid is sourced from PubChem (CID 134852828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).