C15H30O6Si — CID 134852829
(3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxyoxane-3,4,5-triol (PubChem CID 134852829) has the molecular formula C15H30O6Si and a molecular weight of 334.49 g/mol. Its IUPAC name is (3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxyoxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 134852829 |
| Molecular Formula | C15H30O6Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxyoxane-3,4,5-triol |
| SMILES | C=CCO[C@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C15H30O6Si/c1-7-8-19-14-13(18)12(17)11(16)10(21-14)9-20-22(5,6)15(2,3)4/h7,10-14,16-18H,1,8-9H2,2-6H3/t10?,11-,12?,13?,14+/m1/s1 |
| InChIKey | RGFUGTHSXKWBIS-IAPOMNSZSA-N |
| XLogP | 1.02 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|