C24H36O8Si — CID 134852830
[(3S,6S)-5-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 134852830) has the molecular formula C24H36O8Si and a molecular weight of 480.63 g/mol. Its IUPAC name is [(3S,6S)-5-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(3S,6S)-5-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134852830 |
| Molecular Formula | C24H36O8Si |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [(3S,6S)-5-acetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@@H](OC(=O)c2ccccc2)C(O)C1OC(C)=O |
| InChI | InChI=1S/C24H36O8Si/c1-8-14-28-23-21(30-16(2)25)19(26)20(32-22(27)17-12-10-9-11-13-17)18(31-23)15-29-33(6,7)24(3,4)5/h8-13,18-21,23,26H,1,14-15H2,2-7H3/t18?,19?,20-,21?,23+/m1/s1 |
| InChIKey | ZWFWWIQHWMNBAP-ZVAYMQCWSA-N |
| XLogP | 3.45 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|