C34H51NO4Si — CID 134852994
methyl 5-butyl-8-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate (PubChem CID 134852994) has the molecular formula C34H51NO4Si and a molecular weight of 565.87 g/mol. Its IUPAC name is methyl 5-butyl-8-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate.
| Compound Name | methyl 5-butyl-8-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate |
|---|---|
| PubChem CID | 134852994 |
| Molecular Formula | C34H51NO4Si |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | methyl 5-butyl-8-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-indolizine-8a-carboxylate |
| SMILES | CCCCC1CCC(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C2(C(=O)OC)CCC(CO)N12 |
| InChI | InChI=1S/C34H51NO4Si/c1-6-7-16-28-22-21-27(34(32(37)38-5)24-23-29(26-36)35(28)34)15-14-25-39-40(33(2,3)4,30-17-10-8-11-18-30)31-19-12-9-13-20-31/h8-13,17-20,27-29,36H,6-7,14-16,21-26H2,1-5H3 |
| InChIKey | FXSQLSGDFGOYQU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|