C14H15NO2 — CID 134853029
8a-hydroxy-2-phenyl-5,6,7,8-tetrahydroindolizin-3-one (PubChem CID 134853029) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 8a-hydroxy-2-phenyl-5,6,7,8-tetrahydroindolizin-3-one.
| Compound Name | 8a-hydroxy-2-phenyl-5,6,7,8-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 134853029 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 8a-hydroxy-2-phenyl-5,6,7,8-tetrahydroindolizin-3-one |
| SMILES | O=C1C(c2ccccc2)=CC2(O)CCCCN12 |
| InChI | InChI=1S/C14H15NO2/c16-13-12(11-6-2-1-3-7-11)10-14(17)8-4-5-9-15(13)14/h1-3,6-7,10,17H,4-5,8-9H2 |
| InChIKey | YACFJVNGOUBTPK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |