C18H22O3 — CID 134853072
ethyl (1R,2R,3aR,6aR)-2-benzoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate (PubChem CID 134853072) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is ethyl (1R,2R,3aR,6aR)-2-benzoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate.
| Compound Name | ethyl (1R,2R,3aR,6aR)-2-benzoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 134853072 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | ethyl (1R,2R,3aR,6aR)-2-benzoyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CCC[C@@H]2C[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-2-21-18(20)16-14-10-6-9-13(14)11-15(16)17(19)12-7-4-3-5-8-12/h3-5,7-8,13-16H,2,6,9-11H2,1H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | VFVJKRAONZFSJB-KLHDSHLOSA-N |
| XLogP | 3.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |