C40H55NO4Si — CID 134853168
tert-butyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-oxopyrrolidine-1-carboxylate (PubChem CID 134853168) has the molecular formula C40H55NO4Si and a molecular weight of 641.97 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134853168 |
| Molecular Formula | C40H55NO4Si |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | tert-butyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-octylphenyl)-5-oxopyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCc1ccc([C@H]2CC(=O)N(C(=O)OC(C)(C)C)[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C40H55NO4Si/c1-8-9-10-11-12-15-20-31-25-27-32(28-26-31)35-29-37(42)41(38(43)45-39(2,3)4)36(35)30-44-46(40(5,6)7,33-21-16-13-17-22-33)34-23-18-14-19-24-34/h13-14,16-19,21-28,35-36H,8-12,15,20,29-30H2,1-7H3/t35-,36-/m1/s1 |
| InChIKey | CZKVWXZGAWEAHR-LQFQNGICSA-N |
| XLogP | 8.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|