C22H34O5 — CID 134853219
methyl (E,5S,6R)-5,6-dihydroxy-8-[6-[(1R)-1-hydroxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate (PubChem CID 134853219) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (E,5S,6R)-5,6-dihydroxy-8-[6-[(1R)-1-hydroxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate.
| Compound Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[6-[(1R)-1-hydroxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate |
|---|---|
| PubChem CID | 134853219 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[6-[(1R)-1-hydroxyhexyl]cyclohepta-1,3,5-trien-1-yl]oct-7-enoate |
| SMILES | CCCCC[C@@H](O)C1=CC=CC=C(/C=C/[C@@H](O)[C@@H](O)CCCC(=O)OC)C1 |
| InChI | InChI=1S/C22H34O5/c1-3-4-5-11-19(23)18-10-7-6-9-17(16-18)14-15-21(25)20(24)12-8-13-22(26)27-2/h6-7,9-10,14-15,19-21,23-25H,3-5,8,11-13,16H2,1-2H3/b15-14+/t19-,20+,21-/m1/s1 |
| InChIKey | BVEHKWQYVLZXJJ-LJIYEGFGSA-N |
| XLogP | 3.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|