C16H18O3 — CID 134853260
1,6'-dimethyl-2-methylidenespiro[4,5,6,7-tetrahydro-3aH-indene-3,3'-pyran]-2',4'-dione (PubChem CID 134853260) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1,6'-dimethyl-2-methylidenespiro[4,5,6,7-tetrahydro-3aH-indene-3,3'-pyran]-2',4'-dione.
| Compound Name | 1,6'-dimethyl-2-methylidenespiro[4,5,6,7-tetrahydro-3aH-indene-3,3'-pyran]-2',4'-dione |
|---|---|
| PubChem CID | 134853260 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1,6'-dimethyl-2-methylidenespiro[4,5,6,7-tetrahydro-3aH-indene-3,3'-pyran]-2',4'-dione |
| SMILES | C=C1C(C)=C2CCCCC2C12C(=O)C=C(C)OC2=O |
| InChI | InChI=1S/C16H18O3/c1-9-8-14(17)16(15(18)19-9)11(3)10(2)12-6-4-5-7-13(12)16/h8,13H,3-7H2,1-2H3 |
| InChIKey | HIYHVSOKUJVAIG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|