C17H23NO3 — CID 134853269
(4S,5S)-5-methyl-4-[(E)-6-phenylmethoxyhex-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 134853269) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (4S,5S)-5-methyl-4-[(E)-6-phenylmethoxyhex-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-methyl-4-[(E)-6-phenylmethoxyhex-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134853269 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (4S,5S)-5-methyl-4-[(E)-6-phenylmethoxyhex-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1OC(=O)N[C@H]1C/C=C/CCCOCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-14-16(18-17(19)21-14)11-7-2-3-8-12-20-13-15-9-5-4-6-10-15/h2,4-7,9-10,14,16H,3,8,11-13H2,1H3,(H,18,19)/b7-2+/t14-,16-/m0/s1 |
| InChIKey | WQLRFRQNQSLMNH-FZHYMUGLSA-N |
| XLogP | 3.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|