C18H19FO3S — CID 134853381
3-(benzenesulfonyl)-2-fluoro-1-phenylhex-2-en-1-ol (PubChem CID 134853381) has the molecular formula C18H19FO3S and a molecular weight of 334.41 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-fluoro-1-phenylhex-2-en-1-ol.
| Compound Name | 3-(benzenesulfonyl)-2-fluoro-1-phenylhex-2-en-1-ol |
|---|---|
| PubChem CID | 134853381 |
| Molecular Formula | C18H19FO3S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 3-(benzenesulfonyl)-2-fluoro-1-phenylhex-2-en-1-ol |
| SMILES | CCCC(=C(F)C(O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19FO3S/c1-2-9-16(23(21,22)15-12-7-4-8-13-15)17(19)18(20)14-10-5-3-6-11-14/h3-8,10-13,18,20H,2,9H2,1H3 |
| InChIKey | SJFDJVUZXDJWDW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |