About 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene
2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene (PubChem CID 134853442) has the molecular formula C14H21BrO2
and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene |
| PubChem CID | 134853442 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene |
| SMILES | CCOC(CBr)OCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H21BrO2/c1-5-16-14(8-15)17-9-13-11(3)6-10(2)7-12(13)4/h6-7,14H,5,8-9H2,1-4H3 |
| InChIKey | LCQQSVUIJJKMDQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene?
The IUPAC name of 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene (CID 134853442) is 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene?
The canonical SMILES for 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene is CCOC(CBr)OCc1c(C)cc(C)cc1C.
What is the InChIKey of 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene?
The InChIKey is LCQQSVUIJJKMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrO2/c1-5-16-14(8-15)17-9-13-11(3)6-10(2)7-12(13)4/h6-7,14H,5,8-9H2,1-4H3.
What are the key properties of 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene?
2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene has a molecular weight of 301.22 g/mol, XLogP of 3.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-bromo-1-ethoxyethoxy)methyl]-1,3,5-trimethylbenzene is sourced from PubChem (CID 134853442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).