C17H20O3 — CID 134853462
(5R,10R)-10-(2-phenylethyl)-7-oxaspiro[4.5]decane-4,6-dione (PubChem CID 134853462) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (5R,10R)-10-(2-phenylethyl)-7-oxaspiro[4.5]decane-4,6-dione.
| Compound Name | (5R,10R)-10-(2-phenylethyl)-7-oxaspiro[4.5]decane-4,6-dione |
|---|---|
| PubChem CID | 134853462 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (5R,10R)-10-(2-phenylethyl)-7-oxaspiro[4.5]decane-4,6-dione |
| SMILES | O=C1CCC[C@]12C(=O)OCC[C@H]2CCc1ccccc1 |
| InChI | InChI=1S/C17H20O3/c18-15-7-4-11-17(15)14(10-12-20-16(17)19)9-8-13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2/t14-,17-/m1/s1 |
| InChIKey | HWIFKWWZTCVAKP-RHSMWYFYSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|