C8H5N5O2S — CID 134853526
methyl 7-azidothieno[2,3-b]pyrazine-6-carboxylate (PubChem CID 134853526) has the molecular formula C8H5N5O2S and a molecular weight of 235.23 g/mol. Its IUPAC name is methyl 7-azidothieno[2,3-b]pyrazine-6-carboxylate.
| Compound Name | methyl 7-azidothieno[2,3-b]pyrazine-6-carboxylate |
|---|---|
| PubChem CID | 134853526 |
| Molecular Formula | C8H5N5O2S |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | methyl 7-azidothieno[2,3-b]pyrazine-6-carboxylate |
| SMILES | COC(=O)c1sc2nccnc2c1N=[N+]=[N-] |
| InChI | InChI=1S/C8H5N5O2S/c1-15-8(14)6-4(12-13-9)5-7(16-6)11-3-2-10-5/h2-3H,1H3 |
| InChIKey | IBWRKJXHLDNNLP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|