C18H32O6 — CID 134853593
(3E,5S,8S,14S)-5,8-bis(methoxymethoxy)-14-methyl-1-oxacyclotetradec-3-en-2-one (PubChem CID 134853593) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (3E,5S,8S,14S)-5,8-bis(methoxymethoxy)-14-methyl-1-oxacyclotetradec-3-en-2-one.
| Compound Name | (3E,5S,8S,14S)-5,8-bis(methoxymethoxy)-14-methyl-1-oxacyclotetradec-3-en-2-one |
|---|---|
| PubChem CID | 134853593 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3E,5S,8S,14S)-5,8-bis(methoxymethoxy)-14-methyl-1-oxacyclotetradec-3-en-2-one |
| SMILES | COCO[C@H]1CCCCC[C@H](C)OC(=O)/C=C/[C@@H](OCOC)CC1 |
| InChI | InChI=1S/C18H32O6/c1-15-7-5-4-6-8-16(22-13-20-2)9-10-17(23-14-21-3)11-12-18(19)24-15/h11-12,15-17H,4-10,13-14H2,1-3H3/b12-11+/t15-,16-,17-/m0/s1 |
| InChIKey | NPBHHAGKNOQFHV-ZCKSSPOOSA-N |
| XLogP | 3.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|