C21H21NO4 — CID 134853626
propan-2-yl (2R,3aR,9bR)-4-oxo-9b-phenyl-1,2,3,3a-tetrahydrochromeno[4,3-b]pyrrole-2-carboxylate (PubChem CID 134853626) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is propan-2-yl (2R,3aR,9bR)-4-oxo-9b-phenyl-1,2,3,3a-tetrahydrochromeno[4,3-b]pyrrole-2-carboxylate.
| Compound Name | propan-2-yl (2R,3aR,9bR)-4-oxo-9b-phenyl-1,2,3,3a-tetrahydrochromeno[4,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 134853626 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | propan-2-yl (2R,3aR,9bR)-4-oxo-9b-phenyl-1,2,3,3a-tetrahydrochromeno[4,3-b]pyrrole-2-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1C[C@H]2C(=O)Oc3ccccc3[C@@]2(c2ccccc2)N1 |
| InChI | InChI=1S/C21H21NO4/c1-13(2)25-20(24)17-12-16-19(23)26-18-11-7-6-10-15(18)21(16,22-17)14-8-4-3-5-9-14/h3-11,13,16-17,22H,12H2,1-2H3/t16-,17+,21+/m0/s1 |
| InChIKey | ZFLBLFJBEDWMJK-CSODHUTKSA-N |
| XLogP | 2.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|