C15H25NO2 — CID 134853666
tert-butyl (1S,3S,5R)-3-ethyl-1-[(E)-prop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 134853666) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is tert-butyl (1S,3S,5R)-3-ethyl-1-[(E)-prop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1S,3S,5R)-3-ethyl-1-[(E)-prop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 134853666 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | tert-butyl (1S,3S,5R)-3-ethyl-1-[(E)-prop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C/C=C/[C@]12C[C@H]1C[C@H](CC)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO2/c1-6-8-15-10-11(15)9-12(7-2)16(15)13(17)18-14(3,4)5/h6,8,11-12H,7,9-10H2,1-5H3/b8-6+/t11-,12+,15+/m1/s1 |
| InChIKey | SPCQDHFRTOLWNH-DZZBCSMTSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|