C14H23NO5 — CID 134853735
tert-butyl (4S)-2,2-dimethyl-4-(2-oxoethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 134853735) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-(2-oxoethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-(2-oxoethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 134853735 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-(2-oxoethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2OC(C)(C)OC2[C@@H]1CC=O |
| InChI | InChI=1S/C14H23NO5/c1-13(2,3)20-12(17)15-8-10-11(9(15)6-7-16)19-14(4,5)18-10/h7,9-11H,6,8H2,1-5H3/t9-,10?,11?/m0/s1 |
| InChIKey | KFLLNOAAZZZKLG-WHXUTIOJSA-N |
| XLogP | 1.71 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|