About [tert-butyl(dimethyl)silyl] diphenyl phosphite
[tert-butyl(dimethyl)silyl] diphenyl phosphite (PubChem CID 134853847) has the molecular formula C18H25O3PSi
and a molecular weight of 348.45 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] diphenyl phosphite.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] diphenyl phosphite |
| PubChem CID | 134853847 |
| Molecular Formula | C18H25O3PSi |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] diphenyl phosphite |
| SMILES | CC(C)(C)[Si](C)(C)OP(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H25O3PSi/c1-18(2,3)23(4,5)21-22(19-16-12-8-6-9-13-16)20-17-14-10-7-11-15-17/h6-15H,1-5H3 |
| InChIKey | JUPJAQXVRSYMOA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] diphenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] diphenyl phosphite?
The IUPAC name of [tert-butyl(dimethyl)silyl] diphenyl phosphite (CID 134853847) is [tert-butyl(dimethyl)silyl] diphenyl phosphite.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] diphenyl phosphite?
The canonical SMILES for [tert-butyl(dimethyl)silyl] diphenyl phosphite is CC(C)(C)[Si](C)(C)OP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of [tert-butyl(dimethyl)silyl] diphenyl phosphite?
The InChIKey is JUPJAQXVRSYMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25O3PSi/c1-18(2,3)23(4,5)21-22(19-16-12-8-6-9-13-16)20-17-14-10-7-11-15-17/h6-15H,1-5H3.
What are the key properties of [tert-butyl(dimethyl)silyl] diphenyl phosphite?
[tert-butyl(dimethyl)silyl] diphenyl phosphite has a molecular weight of 348.45 g/mol, XLogP of 6.39, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] diphenyl phosphite is sourced from PubChem (CID 134853847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).