About [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate
[(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate (PubChem CID 134853955) has the molecular formula C23H17FO4S
and a molecular weight of 408.45 g/mol. Its IUPAC name is [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate.
Molecular Properties
| Compound Name | [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate |
| PubChem CID | 134853955 |
| Molecular Formula | C23H17FO4S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate |
| SMILES | O=C(OC(/C=C/c1ccccc1)=C(/F)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17FO4S/c24-22(29(26,27)20-14-8-3-9-15-20)21(17-16-18-10-4-1-5-11-18)28-23(25)19-12-6-2-7-13-19/h1-17H/b17-16+,22-21- |
| InChIKey | MSNGKHFZQAAHHA-QSJLUVHRSA-N |
| XLogP | 5.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate?
The IUPAC name of [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate (CID 134853955) is [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate.
What is the SMILES notation for [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate?
The canonical SMILES for [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate is O=C(OC(/C=C/c1ccccc1)=C(/F)S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate?
The InChIKey is MSNGKHFZQAAHHA-QSJLUVHRSA-N. The full InChI is InChI=1S/C23H17FO4S/c24-22(29(26,27)20-14-8-3-9-15-20)21(17-16-18-10-4-1-5-11-18)28-23(25)19-12-6-2-7-13-19/h1-17H/b17-16+,22-21-.
What are the key properties of [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate?
[(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate has a molecular weight of 408.45 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z,3E)-1-(benzenesulfonyl)-1-fluoro-4-phenylbuta-1,3-dien-2-yl] benzoate is sourced from PubChem (CID 134853955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).