C6H10O2S — CID 134854103
2,2-dimethyl-1,3-oxathian-5-one (PubChem CID 134854103) has the molecular formula C6H10O2S and a molecular weight of 146.21 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-oxathian-5-one.
| Compound Name | 2,2-dimethyl-1,3-oxathian-5-one |
|---|---|
| PubChem CID | 134854103 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 2,2-dimethyl-1,3-oxathian-5-one |
| SMILES | CC1(C)OCC(=O)CS1 |
| InChI | InChI=1S/C6H10O2S/c1-6(2)8-3-5(7)4-9-6/h3-4H2,1-2H3 |
| InChIKey | UJKHGSXKQKOWCM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |