C25H23FO5S2 — CID 134854229
[(1R,5R,6S)-5,6-bis(benzenesulfonyl)-3-fluorocyclohex-2-en-1-yl]oxymethylbenzene (PubChem CID 134854229) has the molecular formula C25H23FO5S2 and a molecular weight of 486.59 g/mol. Its IUPAC name is [(1R,5R,6S)-5,6-bis(benzenesulfonyl)-3-fluorocyclohex-2-en-1-yl]oxymethylbenzene.
| Compound Name | [(1R,5R,6S)-5,6-bis(benzenesulfonyl)-3-fluorocyclohex-2-en-1-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 134854229 |
| Molecular Formula | C25H23FO5S2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [(1R,5R,6S)-5,6-bis(benzenesulfonyl)-3-fluorocyclohex-2-en-1-yl]oxymethylbenzene |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1[C@H](S(=O)(=O)c2ccccc2)CC(F)=C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H23FO5S2/c26-20-16-23(31-18-19-10-4-1-5-11-19)25(33(29,30)22-14-8-3-9-15-22)24(17-20)32(27,28)21-12-6-2-7-13-21/h1-16,23-25H,17-18H2/t23-,24-,25+/m1/s1 |
| InChIKey | FNPMAYIXCQKPPZ-SDHSZQHLSA-N |
| XLogP | 4.51 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |