C23H28N4OS — CID 13485430
(NZ)-N-(3,5-dimethyl-4,6-diphenyl-1,3,5-thiadiazinan-2-ylidene)piperidine-1-carboxamide (PubChem CID 13485430) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (NZ)-N-(3,5-dimethyl-4,6-diphenyl-1,3,5-thiadiazinan-2-ylidene)piperidine-1-carboxamide.
| Compound Name | (NZ)-N-(3,5-dimethyl-4,6-diphenyl-1,3,5-thiadiazinan-2-ylidene)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 13485430 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (NZ)-N-(3,5-dimethyl-4,6-diphenyl-1,3,5-thiadiazinan-2-ylidene)piperidine-1-carboxamide |
| SMILES | CN1/C(=N/C(=O)N2CCCCC2)SC(c2ccccc2)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C23H28N4OS/c1-25-20(18-12-6-3-7-13-18)26(2)23(24-22(28)27-16-10-5-11-17-27)29-21(25)19-14-8-4-9-15-19/h3-4,6-9,12-15,20-21H,5,10-11,16-17H2,1-2H3/b24-23- |
| InChIKey | CSVPZCLRUUZBMB-VHXPQNKSSA-N |
| XLogP | 4.96 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|