C22H15N3 — CID 134854362
4-(1,2-diphenylimidazol-4-yl)benzonitrile (PubChem CID 134854362) has the molecular formula C22H15N3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-(1,2-diphenylimidazol-4-yl)benzonitrile.
| Compound Name | 4-(1,2-diphenylimidazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 134854362 |
| Molecular Formula | C22H15N3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-(1,2-diphenylimidazol-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cn(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H15N3/c23-15-17-11-13-18(14-12-17)21-16-25(20-9-5-2-6-10-20)22(24-21)19-7-3-1-4-8-19/h1-14,16H |
| InChIKey | AVXWZXDCUVIGIH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |