C12H24Si — CID 134854413
trimethyl-[(1S,2S)-2-prop-2-enyl-2-propylcyclopropyl]silane (PubChem CID 134854413) has the molecular formula C12H24Si and a molecular weight of 196.41 g/mol. Its IUPAC name is trimethyl-[(1S,2S)-2-prop-2-enyl-2-propylcyclopropyl]silane.
| Compound Name | trimethyl-[(1S,2S)-2-prop-2-enyl-2-propylcyclopropyl]silane |
|---|---|
| PubChem CID | 134854413 |
| Molecular Formula | C12H24Si |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | trimethyl-[(1S,2S)-2-prop-2-enyl-2-propylcyclopropyl]silane |
| SMILES | C=CC[C@@]1(CCC)C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si/c1-6-8-12(9-7-2)10-11(12)13(3,4)5/h6,11H,1,7-10H2,2-5H3/t11-,12+/m0/s1 |
| InChIKey | ANPUGVPQEYXHPK-NWDGAFQWSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|