C16H18F2O6 — CID 134854430
(2R,7R)-6,12-difluoro-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 134854430) has the molecular formula C16H18F2O6 and a molecular weight of 344.31 g/mol. Its IUPAC name is (2R,7R)-6,12-difluoro-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (2R,7R)-6,12-difluoro-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 134854430 |
| Molecular Formula | C16H18F2O6 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (2R,7R)-6,12-difluoro-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | COC1(OC)C(=O)C2C(F)=CC1[C@@H]1[C@H]2C(F)=CC(=O)C1(OC)OC |
| InChI | InChI=1S/C16H18F2O6/c1-21-15(22-2)7-5-8(17)12(14(15)20)11-9(18)6-10(19)16(23-3,24-4)13(7)11/h5-7,11-13H,1-4H3/t7?,11-,12?,13+/m0/s1 |
| InChIKey | XWXAOPVGKBQLOZ-BIYPHMFPSA-N |
| XLogP | 1.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|