C15H14N2O — CID 134854461
16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-ylhydrazine (PubChem CID 134854461) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-ylhydrazine.
| Compound Name | 16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-ylhydrazine |
|---|---|
| PubChem CID | 134854461 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 16-oxatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-1-ylhydrazine |
| SMILES | NNC12OC(Cc3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C15H14N2O/c16-17-15-12-7-3-1-5-10(12)9-14(18-15)11-6-2-4-8-13(11)15/h1-8,14,17H,9,16H2 |
| InChIKey | CSQBCRJTFDJLGP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|