About ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate
ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate (PubChem CID 134854517) has the molecular formula C6H13NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate |
| PubChem CID | 134854517 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate |
| SMILES | [2H][C@H](C)[C@@H]([2H])NC(=O)OCC |
| InChI | InChI=1S/C6H13NO2/c1-3-5-7-6(8)9-4-2/h3-5H2,1-2H3,(H,7,8)/i3D,5D/t3-,5-/m1/s1 |
| InChIKey | GTOKAWYXANYGFG-HFZXXLHXSA-N |
| XLogP | 1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate?
The IUPAC name of ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate (CID 134854517) is ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate.
What is the SMILES notation for ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate?
The canonical SMILES for ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate is [2H][C@H](C)[C@@H]([2H])NC(=O)OCC.
What is the InChIKey of ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate?
The InChIKey is GTOKAWYXANYGFG-HFZXXLHXSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-5-7-6(8)9-4-2/h3-5H2,1-2H3,(H,7,8)/i3D,5D/t3-,5-/m1/s1.
What are the key properties of ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate?
ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate has a molecular weight of 133.19 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(1R,2R)-1,2-dideuteriopropyl]carbamate is sourced from PubChem (CID 134854517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).