C15H24O2 — CID 134854538
(6E)-9,9-diethoxy-2,6-dimethylnona-2,6-dien-4-yne (PubChem CID 134854538) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (6E)-9,9-diethoxy-2,6-dimethylnona-2,6-dien-4-yne.
| Compound Name | (6E)-9,9-diethoxy-2,6-dimethylnona-2,6-dien-4-yne |
|---|---|
| PubChem CID | 134854538 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (6E)-9,9-diethoxy-2,6-dimethylnona-2,6-dien-4-yne |
| SMILES | CCOC(C/C=C(\C)C#CC=C(C)C)OCC |
| InChI | InChI=1S/C15H24O2/c1-6-16-15(17-7-2)12-11-14(5)10-8-9-13(3)4/h9,11,15H,6-7,12H2,1-5H3/b14-11+ |
| InChIKey | DTIMTKDWPRDKRE-SDNWHVSQSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|