About (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane
(3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane (PubChem CID 134854847) has the molecular formula C9H13F5
and a molecular weight of 216.19 g/mol. Its IUPAC name is (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane.
Molecular Properties
| Compound Name | (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane |
| PubChem CID | 134854847 |
| Molecular Formula | C9H13F5 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane |
| SMILES | CCCCCC1[C@@H](C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C9H13F5/c1-2-3-4-5-6-7(8(6,10)11)9(12,13)14/h6-7H,2-5H2,1H3/t6?,7-/m1/s1 |
| InChIKey | JFEKQGCVMPDZJW-COBSHVIPSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane?
The IUPAC name of (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane (CID 134854847) is (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane.
What is the SMILES notation for (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane?
The canonical SMILES for (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane is CCCCCC1[C@@H](C(F)(F)F)C1(F)F.
What is the InChIKey of (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane?
The InChIKey is JFEKQGCVMPDZJW-COBSHVIPSA-N. The full InChI is InChI=1S/C9H13F5/c1-2-3-4-5-6-7(8(6,10)11)9(12,13)14/h6-7H,2-5H2,1H3/t6?,7-/m1/s1.
What are the key properties of (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane?
(3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane has a molecular weight of 216.19 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,1-difluoro-2-pentyl-3-(trifluoromethyl)cyclopropane is sourced from PubChem (CID 134854847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).