C16H19NO — CID 13485486
3-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzoxazole (PubChem CID 13485486) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 13485486 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3-(2,4,6-trimethylphenyl)-3a,4,7,7a-tetrahydro-1,2-benzoxazole |
| SMILES | Cc1cc(C)c(C2=NOC3CC=CCC23)c(C)c1 |
| InChI | InChI=1S/C16H19NO/c1-10-8-11(2)15(12(3)9-10)16-13-6-4-5-7-14(13)18-17-16/h4-5,8-9,13-14H,6-7H2,1-3H3 |
| InChIKey | KFHRTWCPFZLTSZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|