C16H34O4 — CID 134854869
(3R,7S)-1,9-bis(methoxymethoxy)-3,5,7-trimethylnonane (PubChem CID 134854869) has the molecular formula C16H34O4 and a molecular weight of 290.44 g/mol. Its IUPAC name is (3R,7S)-1,9-bis(methoxymethoxy)-3,5,7-trimethylnonane.
| Compound Name | (3R,7S)-1,9-bis(methoxymethoxy)-3,5,7-trimethylnonane |
|---|---|
| PubChem CID | 134854869 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | (3R,7S)-1,9-bis(methoxymethoxy)-3,5,7-trimethylnonane |
| SMILES | COCOCC[C@@H](C)CC(C)C[C@@H](C)CCOCOC |
| InChI | InChI=1S/C16H34O4/c1-14(6-8-19-12-17-4)10-16(3)11-15(2)7-9-20-13-18-5/h14-16H,6-13H2,1-5H3/t14-,15+,16? |
| InChIKey | ITXUDIHXTPKARM-XYPWUTKMSA-N |
| XLogP | 3.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|