About (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde
(2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde (PubChem CID 134854916) has the molecular formula C16H28O2Si
and a molecular weight of 280.48 g/mol. Its IUPAC name is (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde.
Molecular Properties
| Compound Name | (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde |
| PubChem CID | 134854916 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde |
| SMILES | C/C=C\C[Si@]1(C(C)(C)C)O[C@H](CCC)C/C1=C/C=O |
| InChI | InChI=1S/C16H28O2Si/c1-6-8-12-19(16(3,4)5)15(10-11-17)13-14(18-19)9-7-2/h6,8,10-11,14H,7,9,12-13H2,1-5H3/b8-6-,15-10-/t14-,19+/m1/s1 |
| InChIKey | NYYUSVFBXWXOLN-XIJFIRDPSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde?
The IUPAC name of (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde (CID 134854916) is (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde.
What is the SMILES notation for (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde?
The canonical SMILES for (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde is C/C=C\C[Si@]1(C(C)(C)C)O[C@H](CCC)C/C1=C/C=O.
What is the InChIKey of (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde?
The InChIKey is NYYUSVFBXWXOLN-XIJFIRDPSA-N. The full InChI is InChI=1S/C16H28O2Si/c1-6-8-12-19(16(3,4)5)15(10-11-17)13-14(18-19)9-7-2/h6,8,10-11,14H,7,9,12-13H2,1-5H3/b8-6-,15-10-/t14-,19+/m1/s1.
What are the key properties of (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde?
(2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde has a molecular weight of 280.48 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(2R,5R)-2-[(Z)-but-2-enyl]-2-tert-butyl-5-propyloxasilolan-3-ylidene]acetaldehyde is sourced from PubChem (CID 134854916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).