C16H24O2 — CID 134855023
(1R,5S,6R)-5-(hydroxymethyl)-5,9,10-trimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one (PubChem CID 134855023) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,5S,6R)-5-(hydroxymethyl)-5,9,10-trimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one.
| Compound Name | (1R,5S,6R)-5-(hydroxymethyl)-5,9,10-trimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one |
|---|---|
| PubChem CID | 134855023 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,5S,6R)-5-(hydroxymethyl)-5,9,10-trimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one |
| SMILES | CC1=CC(=O)[C@]23CCC(C)[C@]12CCC[C@]3(C)CO |
| InChI | InChI=1S/C16H24O2/c1-11-5-8-16-13(18)9-12(2)15(11,16)7-4-6-14(16,3)10-17/h9,11,17H,4-8,10H2,1-3H3/t11?,14-,15-,16+/m1/s1 |
| InChIKey | VHXFFLHENAJZPL-ABPYZFRZSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |