About (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one
(3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one (PubChem CID 134855066) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one.
Molecular Properties
| Compound Name | (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one |
| PubChem CID | 134855066 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one |
| SMILES | COC1=C2C(C)=CC(=O)C[C@]2(C)C(C)=C1C(C)C |
| InChI | InChI=1S/C16H22O2/c1-9(2)13-11(4)16(5)8-12(17)7-10(3)14(16)15(13)18-6/h7,9H,8H2,1-6H3/t16-/m1/s1 |
| InChIKey | QUISFVKUHWEVHY-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one?
The IUPAC name of (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one (CID 134855066) is (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one.
What is the SMILES notation for (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one?
The canonical SMILES for (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one is COC1=C2C(C)=CC(=O)C[C@]2(C)C(C)=C1C(C)C.
What is the InChIKey of (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one?
The InChIKey is QUISFVKUHWEVHY-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H22O2/c1-9(2)13-11(4)16(5)8-12(17)7-10(3)14(16)15(13)18-6/h7,9H,8H2,1-6H3/t16-/m1/s1.
What are the key properties of (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one?
(3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one has a molecular weight of 246.35 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aR)-1-methoxy-3,3a,7-trimethyl-2-propan-2-yl-4H-inden-5-one is sourced from PubChem (CID 134855066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).